C20H19BrFNO5S — CID 176836378
benzyl (7aR)-4-[(3-bromo-2-fluorophenyl)methyl]-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate (PubChem CID 176836378) has the molecular formula C20H19BrFNO5S and a molecular weight of 484.34 g/mol. Its IUPAC name is benzyl (7aR)-4-[(3-bromo-2-fluorophenyl)methyl]-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (7aR)-4-[(3-bromo-2-fluorophenyl)methyl]-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 176836378 |
| Molecular Formula | C20H19BrFNO5S |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | benzyl (7aR)-4-[(3-bromo-2-fluorophenyl)methyl]-2-oxo-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxathiolo[4,5-c]pyridine-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H]2OS(=O)OC2C1Cc1cccc(Br)c1F |
| InChI | InChI=1S/C20H19BrFNO5S/c21-15-8-4-7-14(18(15)22)11-16-19-17(27-29(25)28-19)9-10-23(16)20(24)26-12-13-5-2-1-3-6-13/h1-8,16-17,19H,9-12H2/t16?,17-,19?,29?/m1/s1 |
| InChIKey | KDTDNPNNOVXLQE-DCGHDFCCSA-N |
| XLogP | 3.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |