C20H17ClF5NO5S — CID 154617356
benzyl (2S,3S,4S)-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylate (PubChem CID 154617356) has the molecular formula C20H17ClF5NO5S and a molecular weight of 513.87 g/mol. Its IUPAC name is benzyl (2S,3S,4S)-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4S)-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154617356 |
| Molecular Formula | C20H17ClF5NO5S |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | benzyl (2S,3S,4S)-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](F)[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H]1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C20H17ClF5NO5S/c21-14-8-4-7-13(17(14)23)9-16-18(32-33(29,30)20(24,25)26)15(22)10-27(16)19(28)31-11-12-5-2-1-3-6-12/h1-8,15-16,18H,9-11H2/t15-,16-,18+/m0/s1 |
| InChIKey | VYLRZZDURWDZKD-XYJFISCASA-N |
| XLogP | 4.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|