C20H17ClF5NO5S — CID 175360918
(2S,3S,4S)-2-benzyl-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylic acid (PubChem CID 175360918) has the molecular formula C20H17ClF5NO5S and a molecular weight of 513.87 g/mol. Its IUPAC name is (2S,3S,4S)-2-benzyl-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,3S,4S)-2-benzyl-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175360918 |
| Molecular Formula | C20H17ClF5NO5S |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | (2S,3S,4S)-2-benzyl-2-[(3-chloro-2-fluorophenyl)methyl]-4-fluoro-3-(trifluoromethylsulfonyloxy)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1C[C@H](F)[C@@H](OS(=O)(=O)C(F)(F)F)[C@]1(Cc1ccccc1)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C20H17ClF5NO5S/c21-14-8-4-7-13(16(14)23)10-19(9-12-5-2-1-3-6-12)17(15(22)11-27(19)18(28)29)32-33(30,31)20(24,25)26/h1-8,15,17H,9-11H2,(H,28,29)/t15-,17+,19-/m0/s1 |
| InChIKey | CWZSHULNFLNFSR-WDYCEAGBSA-N |
| XLogP | 4.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|