C17H20ClN7O2 — CID 170609999
N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6-chloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide (PubChem CID 170609999) has the molecular formula C17H20ClN7O2 and a molecular weight of 389.85 g/mol. Its IUPAC name is N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6-chloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide.
| Compound Name | N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6-chloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide |
|---|---|
| PubChem CID | 170609999 |
| Molecular Formula | C17H20ClN7O2 |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6-chloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)cc2c1c(-c1cn[nH]c1)cn2/C(N)=C/N(N)CCO |
| InChI | InChI=1S/C17H20ClN7O2/c1-10(27)23-14-4-12(18)5-15-17(14)13(11-6-21-22-7-11)8-25(15)16(19)9-24(20)2-3-26/h4-9,26H,2-3,19-20H2,1H3,(H,21,22)(H,23,27)/b16-9+ |
| InChIKey | ZBVJUZKNWYNBGL-CXUHLZMHSA-N |
| XLogP | 1.53 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|