C17H19Cl2N7O2 — CID 170609778
N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide (PubChem CID 170609778) has the molecular formula C17H19Cl2N7O2 and a molecular weight of 424.29 g/mol. Its IUPAC name is N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide.
| Compound Name | N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide |
|---|---|
| PubChem CID | 170609778 |
| Molecular Formula | C17H19Cl2N7O2 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(Cl)c2c1c(-c1cn[nH]c1)cn2/C(N)=C/N(N)CCO |
| InChI | InChI=1S/C17H19Cl2N7O2/c1-9(28)24-13-4-12(18)16(19)17-15(13)11(10-5-22-23-6-10)7-26(17)14(20)8-25(21)2-3-27/h4-8,27H,2-3,20-21H2,1H3,(H,22,23)(H,24,28)/b14-8+ |
| InChIKey | JOCMPRCQDIGTQY-RIYZIHGNSA-N |
| XLogP | 2.18 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|