C15H17N5O2 — CID 170610802
6-imidazol-1-yl-4-methyl-N-[(3R)-2-oxopiperidin-3-yl]pyridine-2-carboxamide (PubChem CID 170610802) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 6-imidazol-1-yl-4-methyl-N-[(3R)-2-oxopiperidin-3-yl]pyridine-2-carboxamide.
| Compound Name | 6-imidazol-1-yl-4-methyl-N-[(3R)-2-oxopiperidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170610802 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 6-imidazol-1-yl-4-methyl-N-[(3R)-2-oxopiperidin-3-yl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H]2CCCNC2=O)nc(-n2ccnc2)c1 |
| InChI | InChI=1S/C15H17N5O2/c1-10-7-12(18-13(8-10)20-6-5-16-9-20)15(22)19-11-3-2-4-17-14(11)21/h5-9,11H,2-4H2,1H3,(H,17,21)(H,19,22)/t11-/m1/s1 |
| InChIKey | LENPARFAECBBFY-LLVKDONJSA-N |
| XLogP | 0.58 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |