C24H48N2O4S2 — CID 170610803
1-cyclohexylsulfonyl-4-ethylpiperidine;4-propan-2-yl-1-propylsulfonylpiperidine (PubChem CID 170610803) has the molecular formula C24H48N2O4S2 and a molecular weight of 492.79 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-4-ethylpiperidine;4-propan-2-yl-1-propylsulfonylpiperidine.
| Compound Name | 1-cyclohexylsulfonyl-4-ethylpiperidine;4-propan-2-yl-1-propylsulfonylpiperidine |
|---|---|
| PubChem CID | 170610803 |
| Molecular Formula | C24H48N2O4S2 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 1-cyclohexylsulfonyl-4-ethylpiperidine;4-propan-2-yl-1-propylsulfonylpiperidine |
| SMILES | CCC1CCN(S(=O)(=O)C2CCCCC2)CC1.CCCS(=O)(=O)N1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C13H25NO2S.C11H23NO2S/c1-2-12-8-10-14(11-9-12)17(15,16)13-6-4-3-5-7-13;1-4-9-15(13,14)12-7-5-11(6-8-12)10(2)3/h12-13H,2-11H2,1H3;10-11H,4-9H2,1-3H3 |
| InChIKey | PCKCEWMSQZHTCM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |