C31H38N2O3 — CID 170611088
N-[4-[7-(5-aminopentyl)-3-(3-methylphenyl)-3,4-dihydro-2H-chromen-4-yl]phenyl]acetamide;ethenol (PubChem CID 170611088) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[4-[7-(5-aminopentyl)-3-(3-methylphenyl)-3,4-dihydro-2H-chromen-4-yl]phenyl]acetamide;ethenol.
| Compound Name | N-[4-[7-(5-aminopentyl)-3-(3-methylphenyl)-3,4-dihydro-2H-chromen-4-yl]phenyl]acetamide;ethenol |
|---|---|
| PubChem CID | 170611088 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | N-[4-[7-(5-aminopentyl)-3-(3-methylphenyl)-3,4-dihydro-2H-chromen-4-yl]phenyl]acetamide;ethenol |
| SMILES | C=CO.CC(=O)Nc1ccc(C2c3ccc(CCCCCN)cc3OCC2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H34N2O2.C2H4O/c1-20-7-6-9-24(17-20)27-19-33-28-18-22(8-4-3-5-16-30)10-15-26(28)29(27)23-11-13-25(14-12-23)31-21(2)32;1-2-3/h6-7,9-15,17-18,27,29H,3-5,8,16,19,30H2,1-2H3,(H,31,32);2-3H,1H2 |
| InChIKey | RMJIAYYBAMMDEY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|