C19H20BrF2NO — CID 170611754
2-[6-[(Z)-1-bromopent-2-en-2-yl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol (PubChem CID 170611754) has the molecular formula C19H20BrF2NO and a molecular weight of 396.28 g/mol. Its IUPAC name is 2-[6-[(Z)-1-bromopent-2-en-2-yl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[(Z)-1-bromopent-2-en-2-yl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 170611754 |
| Molecular Formula | C19H20BrF2NO |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[6-[(Z)-1-bromopent-2-en-2-yl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol |
| SMILES | CC/C=C(\CBr)c1cc(C(C)(C)O)c(F)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H20BrF2NO/c1-4-5-13(11-20)16-10-15(19(2,3)24)17(22)18(23-16)12-6-8-14(21)9-7-12/h5-10,24H,4,11H2,1-3H3/b13-5+ |
| InChIKey | SCEIGPQITQSLBG-WLRTZDKTSA-N |
| XLogP | 5.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|