C28H29F4N3O2 — CID 170612100
2-(2-but-3-enyl-4-fluoroanilino)-5-(trifluoromethyl)benzaldehyde;6-methoxy-N-methyl-2-prop-2-enylpyridin-3-amine (PubChem CID 170612100) has the molecular formula C28H29F4N3O2 and a molecular weight of 515.55 g/mol. Its IUPAC name is 2-(2-but-3-enyl-4-fluoroanilino)-5-(trifluoromethyl)benzaldehyde;6-methoxy-N-methyl-2-prop-2-enylpyridin-3-amine.
| Compound Name | 2-(2-but-3-enyl-4-fluoroanilino)-5-(trifluoromethyl)benzaldehyde;6-methoxy-N-methyl-2-prop-2-enylpyridin-3-amine |
|---|---|
| PubChem CID | 170612100 |
| Molecular Formula | C28H29F4N3O2 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-(2-but-3-enyl-4-fluoroanilino)-5-(trifluoromethyl)benzaldehyde;6-methoxy-N-methyl-2-prop-2-enylpyridin-3-amine |
| SMILES | C=CCCc1cc(F)ccc1Nc1ccc(C(F)(F)F)cc1C=O.C=CCc1nc(OC)ccc1NC |
| InChI | InChI=1S/C18H15F4NO.C10H14N2O/c1-2-3-4-12-10-15(19)6-8-16(12)23-17-7-5-14(18(20,21)22)9-13(17)11-24;1-4-5-9-8(11-2)6-7-10(12-9)13-3/h2,5-11,23H,1,3-4H2;4,6-7,11H,1,5H2,2-3H3 |
| InChIKey | CZEUYBVQGQUTBF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|