C21H17F3N2O3 — CID 46847896
2-[[6-(3-Methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]amino]-5-methylbenzoic acid (PubChem CID 46847896) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[[6-(3-methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]amino]-5-methylbenzoic acid.
| Compound Name | 2-[[6-(3-Methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 46847896 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[[6-(3-methoxyphenyl)-5-(trifluoromethyl)-3-pyridinyl]amino]-5-methylbenzoic acid |
| SMILES | CC1=CC(=C(C=C1)NC2=CC(=C(N=C2)C3=CC(=CC=C3)OC)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C21H17F3N2O3/c1-12-6-7-18(16(8-12)20(27)28)26-14-10-17(21(22,23)24)19(25-11-14)13-4-3-5-15(9-13)29-2/h3-11,26H,1-2H3,(H,27,28) |
| InChIKey | QQPIDLRKALGERB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | 560 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |