C20H14F3LiN2O4 — CID 24987187
lithium 3-[4-(3-methoxyphenyl)-2-(trifluoromethoxy)anilino]pyridine-4-carboxylate (PubChem CID 24987187) has the molecular formula C20H14F3LiN2O4 and a molecular weight of 410.28 g/mol. Its IUPAC name is lithium 3-[4-(3-methoxyphenyl)-2-(trifluoromethoxy)anilino]pyridine-4-carboxylate.
| Compound Name | lithium 3-[4-(3-methoxyphenyl)-2-(trifluoromethoxy)anilino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 24987187 |
| Molecular Formula | C20H14F3LiN2O4 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | lithium 3-[4-(3-methoxyphenyl)-2-(trifluoromethoxy)anilino]pyridine-4-carboxylate |
| SMILES | COc1cccc(-c2ccc(Nc3cnccc3C(=O)[O-])c(OC(F)(F)F)c2)c1.[Li+] |
| InChI | InChI=1S/C20H15F3N2O4.Li/c1-28-14-4-2-3-12(9-14)13-5-6-16(18(10-13)29-20(21,22)23)25-17-11-24-8-7-15(17)19(26)27;/h2-11,25H,1H3,(H,26,27);/q;+1/p-1 |
| InChIKey | RSJSPBIUPPWAFS-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |