C38H43N7O7 — CID 170612552
[(1R,3S)-3-[3-[[2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate (PubChem CID 170612552) has the molecular formula C38H43N7O7 and a molecular weight of 709.80 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[[2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate.
| Compound Name | [(1R,3S)-3-[3-[[2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 170612552 |
| Molecular Formula | C38H43N7O7 |
| Molecular Weight | 709.80 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | [(1R,3S)-3-[3-[[2-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]phenyl]acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)O[C@@H]1CC[C@H](c2cc(NC(=O)Cc3ccc(C4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)cc3)n[nH]2)C1 |
| InChI | InChI=1S/C38H43N7O7/c1-21(2)39-38(51)52-27-9-7-25(18-27)30-20-32(43-42-30)40-34(47)17-22-3-5-23(6-4-22)24-13-15-44(16-14-24)26-8-10-28-29(19-26)37(50)45(36(28)49)31-11-12-33(46)41-35(31)48/h3-6,8,10,19-21,24-25,27,31H,7,9,11-18H2,1-2H3,(H,39,51)(H,41,46,48)(H2,40,42,43,47)/t25-,27+,31?/m0/s1 |
| InChIKey | SZYSYIKHKFWTAU-IPVIFZNSSA-N |
| XLogP | 4.15 |
| TPSA | 182.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|