C36H40N8O7 — CID 170612585
[(1R,3S)-3-[3-[[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]benzoyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate (PubChem CID 170612585) has the molecular formula C36H40N8O7 and a molecular weight of 696.77 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]benzoyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate.
| Compound Name | [(1R,3S)-3-[3-[[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]benzoyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 170612585 |
| Molecular Formula | C36H40N8O7 |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.30 |
| IUPAC Name | [(1R,3S)-3-[3-[[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]benzoyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)O[C@@H]1CC[C@H](c2cc(NC(=O)c3ccc(N4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)cc3)n[nH]2)C1 |
| InChI | InChI=1S/C36H40N8O7/c1-20(2)37-36(50)51-25-9-5-22(17-25)28-19-30(41-40-28)38-32(46)21-3-6-23(7-4-21)42-13-15-43(16-14-42)24-8-10-26-27(18-24)35(49)44(34(26)48)29-11-12-31(45)39-33(29)47/h3-4,6-8,10,18-20,22,25,29H,5,9,11-17H2,1-2H3,(H,37,50)(H,39,45,47)(H2,38,40,41,46)/t22-,25+,29?/m0/s1 |
| InChIKey | UYZCMSYMOZKTKP-ZLIWMMEESA-N |
| XLogP | 3.16 |
| TPSA | 186.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|