C18H29N5 — CID 170613655
2-methyl-6-[4-(2-propan-2-ylpyrimidin-5-yl)piperazin-1-yl]-2-azaspiro[3.3]heptane (PubChem CID 170613655) has the molecular formula C18H29N5 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-methyl-6-[4-(2-propan-2-ylpyrimidin-5-yl)piperazin-1-yl]-2-azaspiro[3.3]heptane.
| Compound Name | 2-methyl-6-[4-(2-propan-2-ylpyrimidin-5-yl)piperazin-1-yl]-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 170613655 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 2-methyl-6-[4-(2-propan-2-ylpyrimidin-5-yl)piperazin-1-yl]-2-azaspiro[3.3]heptane |
| SMILES | CC(C)c1ncc(N2CCN(C3CC4(C3)CN(C)C4)CC2)cn1 |
| InChI | InChI=1S/C18H29N5/c1-14(2)17-19-10-16(11-20-17)23-6-4-22(5-7-23)15-8-18(9-15)12-21(3)13-18/h10-11,14-15H,4-9,12-13H2,1-3H3 |
| InChIKey | WOEVKPRGPDHFSH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |