C23H37N3O — CID 166458947
2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine (PubChem CID 166458947) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine.
| Compound Name | 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine |
|---|---|
| PubChem CID | 166458947 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine |
| SMILES | CC(C)C=O.CC(C)c1ncc(C2CCN(C3CC4(CCC4)C3)CC2)cn1 |
| InChI | InChI=1S/C19H29N3.C4H8O/c1-14(2)18-20-12-16(13-21-18)15-4-8-22(9-5-15)17-10-19(11-17)6-3-7-19;1-4(2)3-5/h12-15,17H,3-11H2,1-2H3;3-4H,1-2H3 |
| InChIKey | ZNRGCBGUNUZGOA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|