About 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine
2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine (PubChem CID 166458947) has the molecular formula C23H37N3O
and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine |
| PubChem CID | 166458947 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine |
| SMILES | CC(C)C=O.CC(C)c1ncc(C2CCN(C3CC4(CCC4)C3)CC2)cn1 |
| InChI | InChI=1S/C19H29N3.C4H8O/c1-14(2)18-20-12-16(13-21-18)15-4-8-22(9-5-15)17-10-19(11-17)6-3-7-19;1-4(2)3-5/h12-15,17H,3-11H2,1-2H3;3-4H,1-2H3 |
| InChIKey | ZNRGCBGUNUZGOA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine?
The IUPAC name of 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine (CID 166458947) is 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine.
What is the SMILES notation for 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine?
The canonical SMILES for 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine is CC(C)C=O.CC(C)c1ncc(C2CCN(C3CC4(CCC4)C3)CC2)cn1.
What is the InChIKey of 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine?
The InChIKey is ZNRGCBGUNUZGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3.C4H8O/c1-14(2)18-20-12-16(13-21-18)15-4-8-22(9-5-15)17-10-19(11-17)6-3-7-19;1-4(2)3-5/h12-15,17H,3-11H2,1-2H3;3-4H,1-2H3.
What are the key properties of 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine?
2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine has a molecular weight of 371.57 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanal;2-propan-2-yl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine is sourced from PubChem (CID 166458947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).