C21H37N3O — CID 166459295
5-(1-cyclohexylpiperidin-4-yl)-2-propan-2-ylpyrimidine;propan-2-ol (PubChem CID 166459295) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is 5-(1-cyclohexylpiperidin-4-yl)-2-propan-2-ylpyrimidine;propan-2-ol.
| Compound Name | 5-(1-cyclohexylpiperidin-4-yl)-2-propan-2-ylpyrimidine;propan-2-ol |
|---|---|
| PubChem CID | 166459295 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | 5-(1-cyclohexylpiperidin-4-yl)-2-propan-2-ylpyrimidine;propan-2-ol |
| SMILES | CC(C)O.CC(C)c1ncc(C2CCN(C3CCCCC3)CC2)cn1 |
| InChI | InChI=1S/C18H29N3.C3H8O/c1-14(2)18-19-12-16(13-20-18)15-8-10-21(11-9-15)17-6-4-3-5-7-17;1-3(2)4/h12-15,17H,3-11H2,1-2H3;3-4H,1-2H3 |
| InChIKey | NOYQSBAEPPNLTJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |