C20H32IN3 — CID 170613883
5-[1-[4-(1-iodoethyl)cyclohexyl]piperidin-4-yl]-2-propan-2-ylpyrimidine (PubChem CID 170613883) has the molecular formula C20H32IN3 and a molecular weight of 441.40 g/mol. Its IUPAC name is 5-[1-[4-(1-iodoethyl)cyclohexyl]piperidin-4-yl]-2-propan-2-ylpyrimidine.
| Compound Name | 5-[1-[4-(1-iodoethyl)cyclohexyl]piperidin-4-yl]-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 170613883 |
| Molecular Formula | C20H32IN3 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 5-[1-[4-(1-iodoethyl)cyclohexyl]piperidin-4-yl]-2-propan-2-ylpyrimidine |
| SMILES | CC(C)c1ncc(C2CCN(C3CCC(C(C)I)CC3)CC2)cn1 |
| InChI | InChI=1S/C20H32IN3/c1-14(2)20-22-12-18(13-23-20)17-8-10-24(11-9-17)19-6-4-16(5-7-19)15(3)21/h12-17,19H,4-11H2,1-3H3 |
| InChIKey | NPMXNTGFTMTPCQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|