C22H37N3O — CID 170613616
ethane;2-methyl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine;propanal (PubChem CID 170613616) has the molecular formula C22H37N3O and a molecular weight of 359.56 g/mol. Its IUPAC name is ethane;2-methyl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine;propanal.
| Compound Name | ethane;2-methyl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine;propanal |
|---|---|
| PubChem CID | 170613616 |
| Molecular Formula | C22H37N3O |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | ethane;2-methyl-5-(1-spiro[3.3]heptan-2-ylpiperidin-4-yl)pyrimidine;propanal |
| SMILES | CC.CCC=O.Cc1ncc(C2CCN(C3CC4(CCC4)C3)CC2)cn1 |
| InChI | InChI=1S/C17H25N3.C3H6O.C2H6/c1-13-18-11-15(12-19-13)14-3-7-20(8-4-14)16-9-17(10-16)5-2-6-17;1-2-3-4;1-2/h11-12,14,16H,2-10H2,1H3;3H,2H2,1H3;1-2H3 |
| InChIKey | ZBNMKNXPTCNZSZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|