C24H22FO8PS2 — CID 170614035
[2-[5-[3-[(4-fluoro-2-formyl-6-methoxy-1-benzothiophen-5-yl)oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-2-oxoethyl]phosphonous acid (PubChem CID 170614035) has the molecular formula C24H22FO8PS2 and a molecular weight of 552.54 g/mol. Its IUPAC name is [2-[5-[3-[(4-fluoro-2-formyl-6-methoxy-1-benzothiophen-5-yl)oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-2-oxoethyl]phosphonous acid.
| Compound Name | [2-[5-[3-[(4-fluoro-2-formyl-6-methoxy-1-benzothiophen-5-yl)oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-2-oxoethyl]phosphonous acid |
|---|---|
| PubChem CID | 170614035 |
| Molecular Formula | C24H22FO8PS2 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | [2-[5-[3-[(4-fluoro-2-formyl-6-methoxy-1-benzothiophen-5-yl)oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-2-oxoethyl]phosphonous acid |
| SMILES | COc1cc2sc(C(=O)CP(O)O)cc2cc1OCCCOc1c(OC)cc2sc(C=O)cc2c1F |
| InChI | InChI=1S/C24H22FO8PS2/c1-30-17-9-20-13(7-22(36-20)16(27)12-34(28)29)6-18(17)32-4-3-5-33-24-19(31-2)10-21-15(23(24)25)8-14(11-26)35-21/h6-11,28-29H,3-5,12H2,1-2H3 |
| InChIKey | FKJKPFFTDOCHSO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|