C15H17FO5S — CID 142319762
cyclopropane;4-fluoro-5,6-dimethoxy-1-benzothiophene-2-carbaldehyde;formic acid (PubChem CID 142319762) has the molecular formula C15H17FO5S and a molecular weight of 328.36 g/mol. Its IUPAC name is cyclopropane;4-fluoro-5,6-dimethoxy-1-benzothiophene-2-carbaldehyde;formic acid.
| Compound Name | cyclopropane;4-fluoro-5,6-dimethoxy-1-benzothiophene-2-carbaldehyde;formic acid |
|---|---|
| PubChem CID | 142319762 |
| Molecular Formula | C15H17FO5S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | cyclopropane;4-fluoro-5,6-dimethoxy-1-benzothiophene-2-carbaldehyde;formic acid |
| SMILES | C1CC1.COc1cc2sc(C=O)cc2c(F)c1OC.O=CO |
| InChI | InChI=1S/C11H9FO3S.C3H6.CH2O2/c1-14-8-4-9-7(3-6(5-13)16-9)10(12)11(8)15-2;1-2-3-1;2-1-3/h3-5H,1-2H3;1-3H2;1H,(H,2,3) |
| InChIKey | LBKOBICWQQFHTM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|