C11H10ClFO3S — CID 139573769
chloro-(4-fluoro-5,6-dimethoxy-1-benzothiophen-2-yl)methanol (PubChem CID 139573769) has the molecular formula C11H10ClFO3S and a molecular weight of 276.72 g/mol. Its IUPAC name is chloro-(4-fluoro-5,6-dimethoxy-1-benzothiophen-2-yl)methanol.
| Compound Name | chloro-(4-fluoro-5,6-dimethoxy-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 139573769 |
| Molecular Formula | C11H10ClFO3S |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | chloro-(4-fluoro-5,6-dimethoxy-1-benzothiophen-2-yl)methanol |
| SMILES | COc1cc2sc(C(O)Cl)cc2c(F)c1OC |
| InChI | InChI=1S/C11H10ClFO3S/c1-15-6-4-7-5(9(13)10(6)16-2)3-8(17-7)11(12)14/h3-4,11,14H,1-2H3 |
| InChIKey | HSIOWKYEXDAKOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|