About (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene
(5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene (PubChem CID 170615838) has the molecular formula C25H35FN2O2
and a molecular weight of 414.57 g/mol. Its IUPAC name is (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene.
Molecular Properties
| Compound Name | (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene |
| PubChem CID | 170615838 |
| Molecular Formula | C25H35FN2O2 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene |
| SMILES | C1C[C@@H]2CNCC1C2.CCN(CCc1ccccc1C)C(=O)O.Fc1ccccc1 |
| InChI | InChI=1S/C12H17NO2.C7H13N.C6H5F/c1-3-13(12(14)15)9-8-11-7-5-4-6-10(11)2;1-2-7-3-6(1)4-8-5-7;7-6-4-2-1-3-5-6/h4-7H,3,8-9H2,1-2H3,(H,14,15);6-8H,1-5H2;1-5H/t;6-,7?;/m.0./s1 |
| InChIKey | MWTUKSGHRWVWHK-RZQGFVILSA-N |
| XLogP | 5.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene?
The IUPAC name of (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene (CID 170615838) is (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene.
What is the SMILES notation for (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene?
The canonical SMILES for (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene is C1C[C@@H]2CNCC1C2.CCN(CCc1ccccc1C)C(=O)O.Fc1ccccc1.
What is the InChIKey of (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene?
The InChIKey is MWTUKSGHRWVWHK-RZQGFVILSA-N. The full InChI is InChI=1S/C12H17NO2.C7H13N.C6H5F/c1-3-13(12(14)15)9-8-11-7-5-4-6-10(11)2;1-2-7-3-6(1)4-8-5-7;7-6-4-2-1-3-5-6/h4-7H,3,8-9H2,1-2H3,(H,14,15);6-8H,1-5H2;1-5H/t;6-,7?;/m.0./s1.
What are the key properties of (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene?
(5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene has a molecular weight of 414.57 g/mol, XLogP of 5.37, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-azabicyclo[3.2.1]octane;ethyl-[2-(2-methylphenyl)ethyl]carbamic acid;fluorobenzene is sourced from PubChem (CID 170615838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).