C27H35N3O2 — CID 78233599
N-[(5,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)methyl]-N-[2-(2-methylphenyl)ethyl]pyridine-4-carboxamide (PubChem CID 78233599) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[(5,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)methyl]-N-[2-(2-methylphenyl)ethyl]pyridine-4-carboxamide.
| Compound Name | N-[(5,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)methyl]-N-[2-(2-methylphenyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 78233599 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | N-[(5,8-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)methyl]-N-[2-(2-methylphenyl)ethyl]pyridine-4-carboxamide |
| SMILES | Cc1ccccc1CCN(CC1CC2C(C)CCC(C)C2NC1=O)C(=O)c1ccncc1 |
| InChI | InChI=1S/C27H35N3O2/c1-18-6-4-5-7-21(18)12-15-30(27(32)22-10-13-28-14-11-22)17-23-16-24-19(2)8-9-20(3)25(24)29-26(23)31/h4-7,10-11,13-14,19-20,23-25H,8-9,12,15-17H2,1-3H3,(H,29,31) |
| InChIKey | IVQRWEARNWWTEH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |