C21H24FN3O3 — CID 170617211
(1S,5R)-N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;methyl formate (PubChem CID 170617211) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is (1S,5R)-N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;methyl formate.
| Compound Name | (1S,5R)-N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;methyl formate |
|---|---|
| PubChem CID | 170617211 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (1S,5R)-N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;methyl formate |
| SMILES | COC=O.Cc1ccc(NC(=O)N2[C@@H]3CCC[C@H]2C3)cc1-c1cncc(F)c1 |
| InChI | InChI=1S/C19H20FN3O.C2H4O2/c1-12-5-6-15(8-18(12)13-7-14(20)11-21-10-13)22-19(24)23-16-3-2-4-17(23)9-16;1-4-2-3/h5-8,10-11,16-17H,2-4,9H2,1H3,(H,22,24);2H,1H3/t16-,17+; |
| InChIKey | XFXAHHICGDGORR-OKZTUQRJSA-N |
| XLogP | 4.14 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|