C22H27FN4O2 — CID 170617322
N,N-dimethylformamide;N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide (PubChem CID 170617322) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is N,N-dimethylformamide;N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide.
| Compound Name | N,N-dimethylformamide;N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide |
|---|---|
| PubChem CID | 170617322 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N,N-dimethylformamide;N-[3-(5-fluoro-3-pyridinyl)-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide |
| SMILES | CN(C)C=O.Cc1ccc(NC(=O)N2C3CCCC2C3)cc1-c1cncc(F)c1 |
| InChI | InChI=1S/C19H20FN3O.C3H7NO/c1-12-5-6-15(8-18(12)13-7-14(20)11-21-10-13)22-19(24)23-16-3-2-4-17(23)9-16;1-4(2)3-5/h5-8,10-11,16-17H,2-4,9H2,1H3,(H,22,24);3H,1-2H3 |
| InChIKey | VHMMQLWDHQCZEK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|