C23H25F2N5O2 — CID 170617286
ethanimidoyl 6-[[2-fluoro-5-(5-fluoro-3-pyridinyl)-4-methylphenyl]carbamoyl]-3-methyl-6-azabicyclo[3.1.1]heptane-1-carboximidate (PubChem CID 170617286) has the molecular formula C23H25F2N5O2 and a molecular weight of 441.48 g/mol. Its IUPAC name is ethanimidoyl 6-[[2-fluoro-5-(5-fluoro-3-pyridinyl)-4-methylphenyl]carbamoyl]-3-methyl-6-azabicyclo[3.1.1]heptane-1-carboximidate.
| Compound Name | ethanimidoyl 6-[[2-fluoro-5-(5-fluoro-3-pyridinyl)-4-methylphenyl]carbamoyl]-3-methyl-6-azabicyclo[3.1.1]heptane-1-carboximidate |
|---|---|
| PubChem CID | 170617286 |
| Molecular Formula | C23H25F2N5O2 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | ethanimidoyl 6-[[2-fluoro-5-(5-fluoro-3-pyridinyl)-4-methylphenyl]carbamoyl]-3-methyl-6-azabicyclo[3.1.1]heptane-1-carboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])C12CC(C)CC(C1)N2C(=O)Nc1cc(-c2cncc(F)c2)c(C)cc1F |
| InChI | InChI=1S/C23H25F2N5O2/c1-12-4-17-9-23(8-12,21(27)32-14(3)26)30(17)22(31)29-20-7-18(13(2)5-19(20)25)15-6-16(24)11-28-10-15/h5-7,10-12,17,26-27H,4,8-9H2,1-3H3,(H,29,31)/b26-14+,27-21- |
| InChIKey | NEYZHVJQCPLEHK-XNTQGQOBSA-N |
| XLogP | 5.10 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|