C14H9BF4N2O — CID 170619797
CID 170619797 (PubChem CID 170619797) has the molecular formula C14H9BF4N2O and a molecular weight of 308.04 g/mol.
| Compound Name | CID 170619797 |
|---|---|
| PubChem CID | 170619797 |
| Molecular Formula | C14H9BF4N2O |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-n2nc(C(F)(F)F)c3c2C(=O)CCC3)ccc1F |
| InChI | InChI=1S/C14H9BF4N2O/c15-9-6-7(4-5-10(9)16)21-12-8(2-1-3-11(12)22)13(20-21)14(17,18)19/h4-6H,1-3H2 |
| InChIKey | IBOQGJDNRZAURA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|