C25H39NO4 — CID 170620353
(E)-2-acetyl-4,4-dimethylpent-2-enenitrile;formic acid;1-methoxy-4-octan-4-ylbenzene (PubChem CID 170620353) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;formic acid;1-methoxy-4-octan-4-ylbenzene.
| Compound Name | (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;formic acid;1-methoxy-4-octan-4-ylbenzene |
|---|---|
| PubChem CID | 170620353 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;formic acid;1-methoxy-4-octan-4-ylbenzene |
| SMILES | CC(=O)/C(C#N)=C/C(C)(C)C.CCCCC(CCC)c1ccc(OC)cc1.O=CO |
| InChI | InChI=1S/C15H24O.C9H13NO.CH2O2/c1-4-6-8-13(7-5-2)14-9-11-15(16-3)12-10-14;1-7(11)8(6-10)5-9(2,3)4;2-1-3/h9-13H,4-8H2,1-3H3;5H,1-4H3;1H,(H,2,3)/b;8-5+; |
| InChIKey | LKTQBEOTZFWLJP-UKXMSUEASA-N |
| XLogP | 6.54 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|