About (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene
(E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene (PubChem CID 170620665) has the molecular formula C25H40FNO3
and a molecular weight of 421.60 g/mol. Its IUPAC name is (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene.
Molecular Properties
| Compound Name | (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene |
| PubChem CID | 170620665 |
| Molecular Formula | C25H40FNO3 |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene |
| SMILES | CC(=O)/C(C#N)=C/C(C)(C)C.CCCCC(CCC)c1ccc(F)cc1.OCCO |
| InChI | InChI=1S/C14H21F.C9H13NO.C2H6O2/c1-3-5-7-12(6-4-2)13-8-10-14(15)11-9-13;1-7(11)8(6-10)5-9(2,3)4;3-1-2-4/h8-12H,3-7H2,1-2H3;5H,1-4H3;3-4H,1-2H2/b;8-5+; |
| InChIKey | GZUZJUFDECHHBQ-UKXMSUEASA-N |
| XLogP | 5.94 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene?
The IUPAC name of (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene (CID 170620665) is (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene.
What is the SMILES notation for (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene?
The canonical SMILES for (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene is CC(=O)/C(C#N)=C/C(C)(C)C.CCCCC(CCC)c1ccc(F)cc1.OCCO.
What is the InChIKey of (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene?
The InChIKey is GZUZJUFDECHHBQ-UKXMSUEASA-N. The full InChI is InChI=1S/C14H21F.C9H13NO.C2H6O2/c1-3-5-7-12(6-4-2)13-8-10-14(15)11-9-13;1-7(11)8(6-10)5-9(2,3)4;3-1-2-4/h8-12H,3-7H2,1-2H3;5H,1-4H3;3-4H,1-2H2/b;8-5+;.
What are the key properties of (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene?
(E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene has a molecular weight of 421.60 g/mol, XLogP of 5.94, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-acetyl-4,4-dimethylpent-2-enenitrile;ethane-1,2-diol;1-fluoro-4-octan-4-ylbenzene is sourced from PubChem (CID 170620665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).