C14H31N3O2 — CID 170620948
ethane;4-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]butanamide (PubChem CID 170620948) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is ethane;4-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]butanamide.
| Compound Name | ethane;4-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 170620948 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | ethane;4-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]butanamide |
| SMILES | CC.COCCCC(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C12H25N3O2.C2H6/c1-14-7-9-15(10-8-14)6-5-13-12(16)4-3-11-17-2;1-2/h3-11H2,1-2H3,(H,13,16);1-2H3 |
| InChIKey | BUTSKTZSRMETQY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|