C16H37N3O2 — CID 170620350
ethane;N-[2-(4-methylpiperazin-1-yl)ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen (PubChem CID 170620350) has the molecular formula C16H37N3O2 and a molecular weight of 303.49 g/mol. Its IUPAC name is ethane;N-[2-(4-methylpiperazin-1-yl)ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen.
| Compound Name | ethane;N-[2-(4-methylpiperazin-1-yl)ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen |
|---|---|
| PubChem CID | 170620350 |
| Molecular Formula | C16H37N3O2 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | ethane;N-[2-(4-methylpiperazin-1-yl)ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen |
| SMILES | CC.CC(C)OCCCC(=O)NCCN1CCN(C)CC1.[H][H] |
| InChI | InChI=1S/C14H29N3O2.C2H6.H2/c1-13(2)19-12-4-5-14(18)15-6-7-17-10-8-16(3)9-11-17;1-2;/h13H,4-12H2,1-3H3,(H,15,18);1-2H3;1H |
| InChIKey | WKVOJXICOYEFNZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|