C31H41N3O — CID 170621871
2-amino-3-[4-[[amino-[1-(2-ethylphenyl)-3-methyl-2-(2-methylphenyl)pentyl]amino]methyl]phenyl]propanal (PubChem CID 170621871) has the molecular formula C31H41N3O and a molecular weight of 471.69 g/mol. Its IUPAC name is 2-amino-3-[4-[[amino-[1-(2-ethylphenyl)-3-methyl-2-(2-methylphenyl)pentyl]amino]methyl]phenyl]propanal.
| Compound Name | 2-amino-3-[4-[[amino-[1-(2-ethylphenyl)-3-methyl-2-(2-methylphenyl)pentyl]amino]methyl]phenyl]propanal |
|---|---|
| PubChem CID | 170621871 |
| Molecular Formula | C31H41N3O |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 2-amino-3-[4-[[amino-[1-(2-ethylphenyl)-3-methyl-2-(2-methylphenyl)pentyl]amino]methyl]phenyl]propanal |
| SMILES | CCc1ccccc1C(C(c1ccccc1C)C(C)CC)N(N)Cc1ccc(CC(N)C=O)cc1 |
| InChI | InChI=1S/C31H41N3O/c1-5-22(3)30(28-13-9-7-11-23(28)4)31(29-14-10-8-12-26(29)6-2)34(33)20-25-17-15-24(16-18-25)19-27(32)21-35/h7-18,21-22,27,30-31H,5-6,19-20,32-33H2,1-4H3 |
| InChIKey | KKIVHINWCIYVCJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|