C18H29NO2 — CID 174041181
(2S)-2-amino-2-methyl-3-[(2S,3S)-4-methyl-3-(2-methylphenyl)hexan-2-yl]oxypropanal (PubChem CID 174041181) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S)-2-amino-2-methyl-3-[(2S,3S)-4-methyl-3-(2-methylphenyl)hexan-2-yl]oxypropanal.
| Compound Name | (2S)-2-amino-2-methyl-3-[(2S,3S)-4-methyl-3-(2-methylphenyl)hexan-2-yl]oxypropanal |
|---|---|
| PubChem CID | 174041181 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2S)-2-amino-2-methyl-3-[(2S,3S)-4-methyl-3-(2-methylphenyl)hexan-2-yl]oxypropanal |
| SMILES | CCC(C)[C@@H](c1ccccc1C)[C@H](C)OC[C@](C)(N)C=O |
| InChI | InChI=1S/C18H29NO2/c1-6-13(2)17(16-10-8-7-9-14(16)3)15(4)21-12-18(5,19)11-20/h7-11,13,15,17H,6,12,19H2,1-5H3/t13?,15-,17+,18+/m0/s1 |
| InChIKey | MPZDSTAIWHWTQS-XTYFKTPNSA-N |
| XLogP | 3.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|