C19H22F5N3O3 — CID 170622799
ethane;ethyl 4-oxo-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[1,2-a][1,8]naphthyridine-8-carboxylate (PubChem CID 170622799) has the molecular formula C19H22F5N3O3 and a molecular weight of 435.39 g/mol. Its IUPAC name is ethane;ethyl 4-oxo-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[1,2-a][1,8]naphthyridine-8-carboxylate.
| Compound Name | ethane;ethyl 4-oxo-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[1,2-a][1,8]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 170622799 |
| Molecular Formula | C19H22F5N3O3 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | ethane;ethyl 4-oxo-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[1,2-a][1,8]naphthyridine-8-carboxylate |
| SMILES | CC.CC.CCOC(=O)c1cn2c(ccc3c(=O)cc(C(F)(F)C(F)(F)F)[nH]c32)n1 |
| InChI | InChI=1S/C15H10F5N3O3.2C2H6/c1-2-26-13(25)8-6-23-11(21-8)4-3-7-9(24)5-10(22-12(7)23)14(16,17)15(18,19)20;2*1-2/h3-6H,2H2,1H3,(H,22,24);2*1-2H3 |
| InChIKey | WENVLHBJWVJCOP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|