C19H26N6O4S — CID 170623291
[(1R,3S)-3-[3-[(1,1-dioxo-2,3-dihydro-[1,2]thiazolo[4,5-b]pyridin-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate (PubChem CID 170623291) has the molecular formula C19H26N6O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[(1,1-dioxo-2,3-dihydro-[1,2]thiazolo[4,5-b]pyridin-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate.
| Compound Name | [(1R,3S)-3-[3-[(1,1-dioxo-2,3-dihydro-[1,2]thiazolo[4,5-b]pyridin-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170623291 |
| Molecular Formula | C19H26N6O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [(1R,3S)-3-[3-[(1,1-dioxo-2,3-dihydro-[1,2]thiazolo[4,5-b]pyridin-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@@H]1CC[C@H](c2cc(Nc3ccc4c(n3)CNS4(=O)=O)n[nH]2)C1 |
| InChI | InChI=1S/C19H26N6O4S/c1-19(2,3)23-18(26)29-12-5-4-11(8-12)13-9-17(25-24-13)22-16-7-6-15-14(21-16)10-20-30(15,27)28/h6-7,9,11-12,20H,4-5,8,10H2,1-3H3,(H,23,26)(H2,21,22,24,25)/t11-,12+/m0/s1 |
| InChIKey | BWBJZIJDIZVBKR-NWDGAFQWSA-N |
| XLogP | 2.50 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |