C20H27N5O4S — CID 170623573
[(1R,3S)-3-[3-[(6,6-dioxo-5,7-dihydrothieno[3,4-b]pyridin-3-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate (PubChem CID 170623573) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[(6,6-dioxo-5,7-dihydrothieno[3,4-b]pyridin-3-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate.
| Compound Name | [(1R,3S)-3-[3-[(6,6-dioxo-5,7-dihydrothieno[3,4-b]pyridin-3-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170623573 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [(1R,3S)-3-[3-[(6,6-dioxo-5,7-dihydrothieno[3,4-b]pyridin-3-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@@H]1CC[C@H](c2cc(Nc3cnc4c(c3)CS(=O)(=O)C4)n[nH]2)C1 |
| InChI | InChI=1S/C20H27N5O4S/c1-20(2,3)23-19(26)29-15-5-4-12(7-15)16-8-18(25-24-16)22-14-6-13-10-30(27,28)11-17(13)21-9-14/h6,8-9,12,15H,4-5,7,10-11H2,1-3H3,(H,23,26)(H2,22,24,25)/t12-,15+/m0/s1 |
| InChIKey | FCHZLOOCOSLAIQ-SWLSCSKDSA-N |
| XLogP | 3.14 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |