C20H23F3N4O4S — CID 177076304
[(1S,3R)-3-[3-[(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-[(2S)-1,1,1-trifluoropropan-2-yl]carbamate (PubChem CID 177076304) has the molecular formula C20H23F3N4O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is [(1S,3R)-3-[3-[(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-[(2S)-1,1,1-trifluoropropan-2-yl]carbamate.
| Compound Name | [(1S,3R)-3-[3-[(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-[(2S)-1,1,1-trifluoropropan-2-yl]carbamate |
|---|---|
| PubChem CID | 177076304 |
| Molecular Formula | C20H23F3N4O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [(1S,3R)-3-[3-[(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-[(2S)-1,1,1-trifluoropropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)O[C@H]1CC[C@@H](c2cc(Nc3ccc4c(c3)CS(=O)(=O)C4)n[nH]2)C1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O4S/c1-11(20(21,22)23)24-19(28)31-16-5-3-12(7-16)17-8-18(27-26-17)25-15-4-2-13-9-32(29,30)10-14(13)6-15/h2,4,6,8,11-12,16H,3,5,7,9-10H2,1H3,(H,24,28)(H2,25,26,27)/t11-,12+,16-/m0/s1 |
| InChIKey | VKDATLYSKNDFSE-OZVIIMIRSA-N |
| XLogP | 3.89 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |