C21H29N3O5 — CID 170625528
2-[4-[4-(1-formamido-1-oxopentan-2-yl)-2,3-dihydro-1,4-benzoxazin-8-yl]piperidin-1-yl]acetic acid (PubChem CID 170625528) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[4-[4-(1-formamido-1-oxopentan-2-yl)-2,3-dihydro-1,4-benzoxazin-8-yl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(1-formamido-1-oxopentan-2-yl)-2,3-dihydro-1,4-benzoxazin-8-yl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 170625528 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[4-[4-(1-formamido-1-oxopentan-2-yl)-2,3-dihydro-1,4-benzoxazin-8-yl]piperidin-1-yl]acetic acid |
| SMILES | CCCC(C(=O)NC=O)N1CCOc2c(C3CCN(CC(=O)O)CC3)cccc21 |
| InChI | InChI=1S/C21H29N3O5/c1-2-4-18(21(28)22-14-25)24-11-12-29-20-16(5-3-6-17(20)24)15-7-9-23(10-8-15)13-19(26)27/h3,5-6,14-15,18H,2,4,7-13H2,1H3,(H,26,27)(H,22,25,28) |
| InChIKey | GQYPOXNQZXNEND-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|