C27H30N6O — CID 170627892
2-[6-amino-5-[(5R)-4-[2-(2-cyclobutylethynyl)-4-pyridinyl]-5-methyl-1,4-diazepan-1-yl]pyridazin-3-yl]phenol (PubChem CID 170627892) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[6-amino-5-[(5R)-4-[2-(2-cyclobutylethynyl)-4-pyridinyl]-5-methyl-1,4-diazepan-1-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[(5R)-4-[2-(2-cyclobutylethynyl)-4-pyridinyl]-5-methyl-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 170627892 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[6-amino-5-[(5R)-4-[2-(2-cyclobutylethynyl)-4-pyridinyl]-5-methyl-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
| SMILES | C[C@@H]1CCN(c2cc(-c3ccccc3O)nnc2N)CCN1c1ccnc(C#CC2CCC2)c1 |
| InChI | InChI=1S/C27H30N6O/c1-19-12-14-32(25-18-24(30-31-27(25)28)23-7-2-3-8-26(23)34)15-16-33(19)22-11-13-29-21(17-22)10-9-20-5-4-6-20/h2-3,7-8,11,13,17-20,34H,4-6,12,14-16H2,1H3,(H2,28,31)/t19-/m1/s1 |
| InChIKey | SKQQHDJFYHVPGK-LJQANCHMSA-N |
| XLogP | 4.08 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|