C29H35N7O — CID 170627906
2-[6-amino-5-[(5S)-5-methyl-4-[2-(3-piperidin-1-ylprop-1-ynyl)-4-pyridinyl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol (PubChem CID 170627906) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-[6-amino-5-[(5S)-5-methyl-4-[2-(3-piperidin-1-ylprop-1-ynyl)-4-pyridinyl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[(5S)-5-methyl-4-[2-(3-piperidin-1-ylprop-1-ynyl)-4-pyridinyl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 170627906 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 2-[6-amino-5-[(5S)-5-methyl-4-[2-(3-piperidin-1-ylprop-1-ynyl)-4-pyridinyl]-1,4-diazepan-1-yl]pyridazin-3-yl]phenol |
| SMILES | C[C@H]1CCN(c2cc(-c3ccccc3O)nnc2N)CCN1c1ccnc(C#CCN2CCCCC2)c1 |
| InChI | InChI=1S/C29H35N7O/c1-22-12-17-35(27-21-26(32-33-29(27)30)25-9-3-4-10-28(25)37)18-19-36(22)24-11-13-31-23(20-24)8-7-16-34-14-5-2-6-15-34/h3-4,9-11,13,20-22,37H,2,5-6,12,14-19H2,1H3,(H2,30,33)/t22-/m0/s1 |
| InChIKey | VHHSHRRDOWXYJW-QFIPXVFZSA-N |
| XLogP | 3.77 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|