C26H26N2O4 — CID 17062936
9-(2,5-dimethoxyphenyl)-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17062936) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 9-(2,5-dimethoxyphenyl)-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(2,5-dimethoxyphenyl)-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17062936 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 9-(2,5-dimethoxyphenyl)-6-(5-methylfuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc(OC)c(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(C)o2)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-15-8-10-24(32-15)26-25-21(27-19-6-4-5-7-20(19)28-26)12-16(13-22(25)29)18-14-17(30-2)9-11-23(18)31-3/h4-11,14,16,26-28H,12-13H2,1-3H3 |
| InChIKey | JMGWEGYQXPAEJJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |