C21H22F5N3O2 — CID 170630178
2-amino-4-(difluoromethyl)-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-morpholin-4-ylbenzamide (PubChem CID 170630178) has the molecular formula C21H22F5N3O2 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-amino-4-(difluoromethyl)-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-morpholin-4-ylbenzamide.
| Compound Name | 2-amino-4-(difluoromethyl)-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 170630178 |
| Molecular Formula | C21H22F5N3O2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-amino-4-(difluoromethyl)-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-5-morpholin-4-ylbenzamide |
| SMILES | C[C@@H](NC(=O)c1cc(N2CCOCC2)c(C(F)F)cc1N)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C21H22F5N3O2/c1-11(12-3-2-4-13(18(12)22)19(23)24)28-21(30)14-10-17(29-5-7-31-8-6-29)15(20(25)26)9-16(14)27/h2-4,9-11,19-20H,5-8,27H2,1H3,(H,28,30)/t11-/m1/s1 |
| InChIKey | FMJLMRQVXKSOLC-LLVKDONJSA-N |
| XLogP | 4.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|