C24H38F3N5O5 — CID 170631860
3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2-formamido-3-(2-oxo-1H-pyridin-3-yl)propanamide;2,2,2-trifluoroacetamide (PubChem CID 170631860) has the molecular formula C24H38F3N5O5 and a molecular weight of 533.59 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2-formamido-3-(2-oxo-1H-pyridin-3-yl)propanamide;2,2,2-trifluoroacetamide.
| Compound Name | 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2-formamido-3-(2-oxo-1H-pyridin-3-yl)propanamide;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170631860 |
| Molecular Formula | C24H38F3N5O5 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2-formamido-3-(2-oxo-1H-pyridin-3-yl)propanamide;2,2,2-trifluoroacetamide |
| SMILES | CC1CN(C(=O)CC(C)(C)C)CC1(C)C.NC(=O)C(Cc1ccc[nH]c1=O)NC=O.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H25NO.C9H11N3O3.C2H2F3NO/c1-10-8-14(9-13(10,5)6)11(15)7-12(2,3)4;10-8(14)7(12-5-13)4-6-2-1-3-11-9(6)15;3-2(4,5)1(6)7/h10H,7-9H2,1-6H3;1-3,5,7H,4H2,(H2,10,14)(H,11,15)(H,12,13);(H2,6,7) |
| InChIKey | JFJCSVBFQSEGHM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 168.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|