C12H6ClF4N3O — CID 170632931
5-chloro-2-fluoro-N-pyrimidin-5-yl-4-(trifluoromethyl)benzamide (PubChem CID 170632931) has the molecular formula C12H6ClF4N3O and a molecular weight of 319.65 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-pyrimidin-5-yl-4-(trifluoromethyl)benzamide.
| Compound Name | 5-chloro-2-fluoro-N-pyrimidin-5-yl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170632931 |
| Molecular Formula | C12H6ClF4N3O |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 5-chloro-2-fluoro-N-pyrimidin-5-yl-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cncnc1)c1cc(Cl)c(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H6ClF4N3O/c13-9-1-7(10(14)2-8(9)12(15,16)17)11(21)20-6-3-18-5-19-4-6/h1-5H,(H,20,21) |
| InChIKey | ICMZBORPXGSEHW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |