C29H37ClF3N6OP — CID 170633134
6-chloro-N-[6-(2-methylbutylideneamino)-3-methylideneheptan-2-yl]-8-(trifluoromethyl)quinazolin-4-amine;[methoxy-(6-methylpyrimidin-4-yl)methylidene]phosphane (PubChem CID 170633134) has the molecular formula C29H37ClF3N6OP and a molecular weight of 609.08 g/mol. Its IUPAC name is 6-chloro-N-[6-(2-methylbutylideneamino)-3-methylideneheptan-2-yl]-8-(trifluoromethyl)quinazolin-4-amine;[methoxy-(6-methylpyrimidin-4-yl)methylidene]phosphane.
| Compound Name | 6-chloro-N-[6-(2-methylbutylideneamino)-3-methylideneheptan-2-yl]-8-(trifluoromethyl)quinazolin-4-amine;[methoxy-(6-methylpyrimidin-4-yl)methylidene]phosphane |
|---|---|
| PubChem CID | 170633134 |
| Molecular Formula | C29H37ClF3N6OP |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 6-chloro-N-[6-(2-methylbutylideneamino)-3-methylideneheptan-2-yl]-8-(trifluoromethyl)quinazolin-4-amine;[methoxy-(6-methylpyrimidin-4-yl)methylidene]phosphane |
| SMILES | C=C(CCC(C)/N=C/C(C)CC)C(C)Nc1ncnc2c(C(F)(F)F)cc(Cl)cc12.[H]/P=C(\OC)c1cc(C)ncn1 |
| InChI | InChI=1S/C22H28ClF3N4.C7H9N2OP/c1-6-13(2)11-27-15(4)8-7-14(3)16(5)30-21-18-9-17(23)10-19(22(24,25)26)20(18)28-12-29-21;1-5-3-6(7(11)10-2)9-4-8-5/h9-13,15-16H,3,6-8H2,1-2,4-5H3,(H,28,29,30);3-4,11H,1-2H3/b27-11+; |
| InChIKey | VNDDRKDMKGMSJA-WVNJMUEZSA-N |
| XLogP | 8.00 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|