C18H16F6N8 — CID 174032245
N-(aminomethylidene)-2-[[6,8-bis(trifluoromethyl)quinazolin-4-yl]amino]-N'-(1,4-dihydropyrimidin-2-yl)propanimidamide (PubChem CID 174032245) has the molecular formula C18H16F6N8 and a molecular weight of 458.37 g/mol. Its IUPAC name is N-(aminomethylidene)-2-[[6,8-bis(trifluoromethyl)quinazolin-4-yl]amino]-N'-(1,4-dihydropyrimidin-2-yl)propanimidamide.
| Compound Name | N-(aminomethylidene)-2-[[6,8-bis(trifluoromethyl)quinazolin-4-yl]amino]-N'-(1,4-dihydropyrimidin-2-yl)propanimidamide |
|---|---|
| PubChem CID | 174032245 |
| Molecular Formula | C18H16F6N8 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-(aminomethylidene)-2-[[6,8-bis(trifluoromethyl)quinazolin-4-yl]amino]-N'-(1,4-dihydropyrimidin-2-yl)propanimidamide |
| SMILES | CC(Nc1ncnc2c(C(F)(F)F)cc(C(F)(F)F)cc12)C(=NC1=NCC=CN1)/N=C/N |
| InChI | InChI=1S/C18H16F6N8/c1-9(14(28-7-25)32-16-26-3-2-4-27-16)31-15-11-5-10(17(19,20)21)6-12(18(22,23)24)13(11)29-8-30-15/h2-3,5-9H,4H2,1H3,(H,29,30,31)(H3,25,26,27,28,32) |
| InChIKey | WLEODFGNTZQFFV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|