C17H14ClF3IN5O — CID 139480301
N-[(2S)-1-(aminomethylideneamino)-1-[(5-iodo-2-pyridinyl)imino]propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide (PubChem CID 139480301) has the molecular formula C17H14ClF3IN5O and a molecular weight of 523.68 g/mol. Its IUPAC name is N-[(2S)-1-(aminomethylideneamino)-1-[(5-iodo-2-pyridinyl)imino]propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-(aminomethylideneamino)-1-[(5-iodo-2-pyridinyl)imino]propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139480301 |
| Molecular Formula | C17H14ClF3IN5O |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | N-[(2S)-1-(aminomethylideneamino)-1-[(5-iodo-2-pyridinyl)imino]propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide |
| SMILES | C[C@H](NC(=O)c1cc(Cl)cc(C(F)(F)F)c1)C(=N/c1ccc(I)cn1)/N=C/N |
| InChI | InChI=1S/C17H14ClF3IN5O/c1-9(15(25-8-23)27-14-3-2-13(22)7-24-14)26-16(28)10-4-11(17(19,20)21)6-12(18)5-10/h2-9H,1H3,(H,26,28)(H2,23,24,25,27)/t9-/m0/s1 |
| InChIKey | HXVVTCARXWDACS-VIFPVBQESA-N |
| XLogP | 4.19 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|