C15H14BrClN6O — CID 155656938
N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-bromo-5-chlorobenzamide (PubChem CID 155656938) has the molecular formula C15H14BrClN6O and a molecular weight of 409.68 g/mol. Its IUPAC name is N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-bromo-5-chlorobenzamide.
| Compound Name | N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-bromo-5-chlorobenzamide |
|---|---|
| PubChem CID | 155656938 |
| Molecular Formula | C15H14BrClN6O |
| Molecular Weight | 409.68 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-bromo-5-chlorobenzamide |
| SMILES | CC(NC(=O)c1cc(Cl)cc(Br)c1)C(/N=C/N)=N\c1ncccn1 |
| InChI | InChI=1S/C15H14BrClN6O/c1-9(13(21-8-18)23-15-19-3-2-4-20-15)22-14(24)10-5-11(16)7-12(17)6-10/h2-9H,1H3,(H,22,24)(H2,18,19,20,21,23) |
| InChIKey | KTLXAKNBBUONSB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|