C21H21F5N6O — CID 156790878
N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-[cyclobutyl(difluoro)methyl]-5-(trifluoromethyl)benzamide (PubChem CID 156790878) has the molecular formula C21H21F5N6O and a molecular weight of 468.43 g/mol. Its IUPAC name is N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-[cyclobutyl(difluoro)methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-[cyclobutyl(difluoro)methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 156790878 |
| Molecular Formula | C21H21F5N6O |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-3-[cyclobutyl(difluoro)methyl]-5-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)C2CCC2)c1)C(/N=C/N)=N\c1ncccn1 |
| InChI | InChI=1S/C21H21F5N6O/c1-12(17(30-11-27)32-19-28-6-3-7-29-19)31-18(33)13-8-15(10-16(9-13)21(24,25)26)20(22,23)14-4-2-5-14/h3,6-12,14H,2,4-5H2,1H3,(H,31,33)(H2,27,28,29,30,32) |
| InChIKey | LDOCDKZURAZMCJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|